C12H13N7O — CID 22871569
[(3S,4S)-3,4-diazidopiperidin-1-yl]-phenylmethanone (PubChem CID 22871569) has the molecular formula C12H13N7O and a molecular weight of 271.28 g/mol. Its IUPAC name is [(3S,4S)-3,4-diazidopiperidin-1-yl]-phenylmethanone.
| Compound Name | [(3S,4S)-3,4-diazidopiperidin-1-yl]-phenylmethanone |
|---|---|
| PubChem CID | 22871569 |
| Molecular Formula | C12H13N7O |
| Molecular Weight | 271.28 g/mol |
| Exact Mass | 271.12 |
| IUPAC Name | [(3S,4S)-3,4-diazidopiperidin-1-yl]-phenylmethanone |
| SMILES | [N-]=[N+]=N[C@H]1CCN(C(=O)c2ccccc2)C[C@@H]1N=[N+]=[N-] |
| InChI | InChI=1S/C12H13N7O/c13-17-15-10-6-7-19(8-11(10)16-18-14)12(20)9-4-2-1-3-5-9/h1-5,10-11H,6-8H2/t10-,11-/m0/s1 |
| InChIKey | HLHVPVXOWPGMQT-QWRGUYRKSA-N |
| XLogP | 2.89 |
| TPSA | 117.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.28 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|