C15H18N4O — CID 19833405
(4-azido-2,3,3a,4,5,6,7,7a-octahydroindol-1-yl)-phenylmethanone (PubChem CID 19833405) has the molecular formula C15H18N4O and a molecular weight of 270.34 g/mol. Its IUPAC name is (4-azido-2,3,3a,4,5,6,7,7a-octahydroindol-1-yl)-phenylmethanone.
| Compound Name | (4-azido-2,3,3a,4,5,6,7,7a-octahydroindol-1-yl)-phenylmethanone |
|---|---|
| PubChem CID | 19833405 |
| Molecular Formula | C15H18N4O |
| Molecular Weight | 270.34 g/mol |
| Exact Mass | 270.15 |
| IUPAC Name | (4-azido-2,3,3a,4,5,6,7,7a-octahydroindol-1-yl)-phenylmethanone |
| SMILES | [N-]=[N+]=NC1CCCC2C1CCN2C(=O)c1ccccc1 |
| InChI | InChI=1S/C15H18N4O/c16-18-17-13-7-4-8-14-12(13)9-10-19(14)15(20)11-5-2-1-3-6-11/h1-3,5-6,12-14H,4,7-10H2 |
| InChIKey | RJCNSBIJMMIYQD-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 69.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.34 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|