C18H26N2O — CID 95241507
phenyl-[(2R)-2-piperidin-4-ylazepan-1-yl]methanone (PubChem CID 95241507) has the molecular formula C18H26N2O and a molecular weight of 286.42 g/mol. Its IUPAC name is phenyl-[(2R)-2-piperidin-4-ylazepan-1-yl]methanone.
| Compound Name | phenyl-[(2R)-2-piperidin-4-ylazepan-1-yl]methanone |
|---|---|
| PubChem CID | 95241507 |
| Molecular Formula | C18H26N2O |
| Molecular Weight | 286.42 g/mol |
| Exact Mass | 286.20 |
| IUPAC Name | phenyl-[(2R)-2-piperidin-4-ylazepan-1-yl]methanone |
| SMILES | O=C(c1ccccc1)N1CCCCC[C@@H]1C1CCNCC1 |
| InChI | InChI=1S/C18H26N2O/c21-18(16-7-3-1-4-8-16)20-14-6-2-5-9-17(20)15-10-12-19-13-11-15/h1,3-4,7-8,15,17,19H,2,5-6,9-14H2/t17-/m1/s1 |
| InChIKey | MYUHGBSBVHUTSZ-QGZVFWFLSA-N |
| XLogP | 3.07 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.42 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |