C26H30N2O4 — CID 167766018
5-[4-(1-benzoylazepan-2-yl)piperidine-1-carbonyl]-2-hydroxybenzaldehyde (PubChem CID 167766018) has the molecular formula C26H30N2O4 and a molecular weight of 434.54 g/mol. Its IUPAC name is 5-[4-(1-benzoylazepan-2-yl)piperidine-1-carbonyl]-2-hydroxybenzaldehyde.
| Compound Name | 5-[4-(1-benzoylazepan-2-yl)piperidine-1-carbonyl]-2-hydroxybenzaldehyde |
|---|---|
| PubChem CID | 167766018 |
| Molecular Formula | C26H30N2O4 |
| Molecular Weight | 434.54 g/mol |
| Exact Mass | 434.22 |
| IUPAC Name | 5-[4-(1-benzoylazepan-2-yl)piperidine-1-carbonyl]-2-hydroxybenzaldehyde |
| SMILES | O=Cc1cc(C(=O)N2CCC(C3CCCCCN3C(=O)c3ccccc3)CC2)ccc1O |
| InChI | InChI=1S/C26H30N2O4/c29-18-22-17-21(10-11-24(22)30)25(31)27-15-12-19(13-16-27)23-9-5-2-6-14-28(23)26(32)20-7-3-1-4-8-20/h1,3-4,7-8,10-11,17-19,23,30H,2,5-6,9,12-16H2 |
| InChIKey | MTYAJFZNCKTVQF-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.54 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|