C26H30N4O — CID 95346656
phenyl-[(2R)-2-(1-quinoxalin-2-ylpiperidin-4-yl)azepan-1-yl]methanone (PubChem CID 95346656) has the molecular formula C26H30N4O and a molecular weight of 414.55 g/mol. Its IUPAC name is phenyl-[(2R)-2-(1-quinoxalin-2-ylpiperidin-4-yl)azepan-1-yl]methanone.
| Compound Name | phenyl-[(2R)-2-(1-quinoxalin-2-ylpiperidin-4-yl)azepan-1-yl]methanone |
|---|---|
| PubChem CID | 95346656 |
| Molecular Formula | C26H30N4O |
| Molecular Weight | 414.55 g/mol |
| Exact Mass | 414.24 |
| IUPAC Name | phenyl-[(2R)-2-(1-quinoxalin-2-ylpiperidin-4-yl)azepan-1-yl]methanone |
| SMILES | O=C(c1ccccc1)N1CCCCC[C@@H]1C1CCN(c2cnc3ccccc3n2)CC1 |
| InChI | InChI=1S/C26H30N4O/c31-26(21-9-3-1-4-10-21)30-16-8-2-5-13-24(30)20-14-17-29(18-15-20)25-19-27-22-11-6-7-12-23(22)28-25/h1,3-4,6-7,9-12,19-20,24H,2,5,8,13-18H2/t24-/m1/s1 |
| InChIKey | FCTMFMVARXMRBB-XMMPIXPASA-N |
| XLogP | 4.93 |
| TPSA | 49.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.55 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |