C26H32N6O — CID 95332947
phenyl-[(2S)-2-[1-[(1-phenyltetrazol-5-yl)methyl]piperidin-4-yl]azepan-1-yl]methanone (PubChem CID 95332947) has the molecular formula C26H32N6O and a molecular weight of 444.58 g/mol. Its IUPAC name is phenyl-[(2S)-2-[1-[(1-phenyltetrazol-5-yl)methyl]piperidin-4-yl]azepan-1-yl]methanone.
| Compound Name | phenyl-[(2S)-2-[1-[(1-phenyltetrazol-5-yl)methyl]piperidin-4-yl]azepan-1-yl]methanone |
|---|---|
| PubChem CID | 95332947 |
| Molecular Formula | C26H32N6O |
| Molecular Weight | 444.58 g/mol |
| Exact Mass | 444.26 |
| IUPAC Name | phenyl-[(2S)-2-[1-[(1-phenyltetrazol-5-yl)methyl]piperidin-4-yl]azepan-1-yl]methanone |
| SMILES | O=C(c1ccccc1)N1CCCCC[C@H]1C1CCN(Cc2nnnn2-c2ccccc2)CC1 |
| InChI | InChI=1S/C26H32N6O/c33-26(22-10-4-1-5-11-22)31-17-9-3-8-14-24(31)21-15-18-30(19-16-21)20-25-27-28-29-32(25)23-12-6-2-7-13-23/h1-2,4-7,10-13,21,24H,3,8-9,14-20H2/t24-/m0/s1 |
| InChIKey | GZKHDGJUZUTMJS-DEOSSOPVSA-N |
| XLogP | 3.96 |
| TPSA | 67.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.58 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |