C16H21N5O — CID 94032320
(4aS,8aS)-4-[(1-phenyltetrazol-5-yl)methyl]-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazine (PubChem CID 94032320) has the molecular formula C16H21N5O and a molecular weight of 299.38 g/mol. Its IUPAC name is (4aS,8aS)-4-[(1-phenyltetrazol-5-yl)methyl]-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazine.
| Compound Name | (4aS,8aS)-4-[(1-phenyltetrazol-5-yl)methyl]-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazine |
|---|---|
| PubChem CID | 94032320 |
| Molecular Formula | C16H21N5O |
| Molecular Weight | 299.38 g/mol |
| Exact Mass | 299.17 |
| IUPAC Name | (4aS,8aS)-4-[(1-phenyltetrazol-5-yl)methyl]-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazine |
| SMILES | c1ccc(-n2nnnc2CN2CCO[C@H]3CCCC[C@@H]32)cc1 |
| InChI | InChI=1S/C16H21N5O/c1-2-6-13(7-3-1)21-16(17-18-19-21)12-20-10-11-22-15-9-5-4-8-14(15)20/h1-3,6-7,14-15H,4-5,8-12H2/t14-,15-/m0/s1 |
| InChIKey | UVCACFLNAOMNCZ-GJZGRUSLSA-N |
| XLogP | 1.81 |
| TPSA | 56.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.38 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |