C16H27N5O2 — CID 124885083
(4aS,8aS)-4-[[1-(oxan-4-ylmethyl)tetrazol-5-yl]methyl]-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazine (PubChem CID 124885083) has the molecular formula C16H27N5O2 and a molecular weight of 321.43 g/mol. Its IUPAC name is (4aS,8aS)-4-[[1-(oxan-4-ylmethyl)tetrazol-5-yl]methyl]-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazine.
| Compound Name | (4aS,8aS)-4-[[1-(oxan-4-ylmethyl)tetrazol-5-yl]methyl]-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazine |
|---|---|
| PubChem CID | 124885083 |
| Molecular Formula | C16H27N5O2 |
| Molecular Weight | 321.43 g/mol |
| Exact Mass | 321.22 |
| IUPAC Name | (4aS,8aS)-4-[[1-(oxan-4-ylmethyl)tetrazol-5-yl]methyl]-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazine |
| SMILES | C1CC[C@H]2[C@H](C1)OCCN2Cc1nnnn1CC1CCOCC1 |
| InChI | InChI=1S/C16H27N5O2/c1-2-4-15-14(3-1)20(7-10-23-15)12-16-17-18-19-21(16)11-13-5-8-22-9-6-13/h13-15H,1-12H2/t14-,15-/m0/s1 |
| InChIKey | VTRKOWXLRCEUGU-GJZGRUSLSA-N |
| XLogP | 1.24 |
| TPSA | 65.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.43 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |