C14H27ClN2O — CID 119930605
4-(piperidin-4-ylmethyl)-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazine;hydrochloride (PubChem CID 119930605) has the molecular formula C14H27ClN2O and a molecular weight of 274.84 g/mol. Its IUPAC name is 4-(piperidin-4-ylmethyl)-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazine;hydrochloride.
| Compound Name | 4-(piperidin-4-ylmethyl)-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazine;hydrochloride |
|---|---|
| PubChem CID | 119930605 |
| Molecular Formula | C14H27ClN2O |
| Molecular Weight | 274.84 g/mol |
| Exact Mass | 274.18 |
| IUPAC Name | 4-(piperidin-4-ylmethyl)-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazine;hydrochloride |
| SMILES | C1CCC2C(C1)OCCN2CC1CCNCC1.Cl |
| InChI | InChI=1S/C14H26N2O.ClH/c1-2-4-14-13(3-1)16(9-10-17-14)11-12-5-7-15-8-6-12;/h12-15H,1-11H2;1H |
| InChIKey | VNCQPBLBZKXRJJ-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.84 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |