C15H23ClN6 — CID 119926252
[3-methyl-1-[(1-phenyltetrazol-5-yl)methyl]piperidin-2-yl]methanamine;hydrochloride (PubChem CID 119926252) has the molecular formula C15H23ClN6 and a molecular weight of 322.84 g/mol. Its IUPAC name is [3-methyl-1-[(1-phenyltetrazol-5-yl)methyl]piperidin-2-yl]methanamine;hydrochloride.
| Compound Name | [3-methyl-1-[(1-phenyltetrazol-5-yl)methyl]piperidin-2-yl]methanamine;hydrochloride |
|---|---|
| PubChem CID | 119926252 |
| Molecular Formula | C15H23ClN6 |
| Molecular Weight | 322.84 g/mol |
| Exact Mass | 322.17 |
| IUPAC Name | [3-methyl-1-[(1-phenyltetrazol-5-yl)methyl]piperidin-2-yl]methanamine;hydrochloride |
| SMILES | CC1CCCN(Cc2nnnn2-c2ccccc2)C1CN.Cl |
| InChI | InChI=1S/C15H22N6.ClH/c1-12-6-5-9-20(14(12)10-16)11-15-17-18-19-21(15)13-7-3-2-4-8-13;/h2-4,7-8,12,14H,5-6,9-11,16H2,1H3;1H |
| InChIKey | XICZLVIMRNLYSG-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 72.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.84 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |