C14H21ClN6 — CID 119920301
N-methyl-1-[(1-phenyltetrazol-5-yl)methyl]piperidin-3-amine;hydrochloride (PubChem CID 119920301) has the molecular formula C14H21ClN6 and a molecular weight of 308.82 g/mol. Its IUPAC name is N-methyl-1-[(1-phenyltetrazol-5-yl)methyl]piperidin-3-amine;hydrochloride.
| Compound Name | N-methyl-1-[(1-phenyltetrazol-5-yl)methyl]piperidin-3-amine;hydrochloride |
|---|---|
| PubChem CID | 119920301 |
| Molecular Formula | C14H21ClN6 |
| Molecular Weight | 308.82 g/mol |
| Exact Mass | 308.15 |
| IUPAC Name | N-methyl-1-[(1-phenyltetrazol-5-yl)methyl]piperidin-3-amine;hydrochloride |
| SMILES | CNC1CCCN(Cc2nnnn2-c2ccccc2)C1.Cl |
| InChI | InChI=1S/C14H20N6.ClH/c1-15-12-6-5-9-19(10-12)11-14-16-17-18-20(14)13-7-3-2-4-8-13;/h2-4,7-8,12,15H,5-6,9-11H2,1H3;1H |
| InChIKey | CEVAARLIQNZBIZ-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 58.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.82 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |