C16H23ClN4 — CID 119919223
N-methyl-1-[(1-phenylpyrazol-3-yl)methyl]piperidin-3-amine;hydrochloride (PubChem CID 119919223) has the molecular formula C16H23ClN4 and a molecular weight of 306.84 g/mol. Its IUPAC name is N-methyl-1-[(1-phenylpyrazol-3-yl)methyl]piperidin-3-amine;hydrochloride.
| Compound Name | N-methyl-1-[(1-phenylpyrazol-3-yl)methyl]piperidin-3-amine;hydrochloride |
|---|---|
| PubChem CID | 119919223 |
| Molecular Formula | C16H23ClN4 |
| Molecular Weight | 306.84 g/mol |
| Exact Mass | 306.16 |
| IUPAC Name | N-methyl-1-[(1-phenylpyrazol-3-yl)methyl]piperidin-3-amine;hydrochloride |
| SMILES | CNC1CCCN(Cc2ccn(-c3ccccc3)n2)C1.Cl |
| InChI | InChI=1S/C16H22N4.ClH/c1-17-14-6-5-10-19(12-14)13-15-9-11-20(18-15)16-7-3-2-4-8-16;/h2-4,7-9,11,14,17H,5-6,10,12-13H2,1H3;1H |
| InChIKey | CWKGYLPLYQDBOP-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 33.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.84 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |