C20H30N4 — CID 120913079
1-[(3-tert-butyl-1-phenylpyrazol-4-yl)methyl]-N-methylpiperidin-3-amine (PubChem CID 120913079) has the molecular formula C20H30N4 and a molecular weight of 326.49 g/mol. Its IUPAC name is 1-[(3-tert-butyl-1-phenylpyrazol-4-yl)methyl]-N-methylpiperidin-3-amine.
| Compound Name | 1-[(3-tert-butyl-1-phenylpyrazol-4-yl)methyl]-N-methylpiperidin-3-amine |
|---|---|
| PubChem CID | 120913079 |
| Molecular Formula | C20H30N4 |
| Molecular Weight | 326.49 g/mol |
| Exact Mass | 326.25 |
| IUPAC Name | 1-[(3-tert-butyl-1-phenylpyrazol-4-yl)methyl]-N-methylpiperidin-3-amine |
| SMILES | CNC1CCCN(Cc2cn(-c3ccccc3)nc2C(C)(C)C)C1 |
| InChI | InChI=1S/C20H30N4/c1-20(2,3)19-16(13-23-12-8-9-17(15-23)21-4)14-24(22-19)18-10-6-5-7-11-18/h5-7,10-11,14,17,21H,8-9,12-13,15H2,1-4H3 |
| InChIKey | FLDVAEUYYQRVTH-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 33.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.49 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |