C17H25Cl2N3 — CID 119918724
N-methyl-1-[(2-methylquinolin-4-yl)methyl]piperidin-3-amine;dihydrochloride (PubChem CID 119918724) has the molecular formula C17H25Cl2N3 and a molecular weight of 342.31 g/mol. Its IUPAC name is N-methyl-1-[(2-methylquinolin-4-yl)methyl]piperidin-3-amine;dihydrochloride.
| Compound Name | N-methyl-1-[(2-methylquinolin-4-yl)methyl]piperidin-3-amine;dihydrochloride |
|---|---|
| PubChem CID | 119918724 |
| Molecular Formula | C17H25Cl2N3 |
| Molecular Weight | 342.31 g/mol |
| Exact Mass | 341.14 |
| IUPAC Name | N-methyl-1-[(2-methylquinolin-4-yl)methyl]piperidin-3-amine;dihydrochloride |
| SMILES | CNC1CCCN(Cc2cc(C)nc3ccccc23)C1.Cl.Cl |
| InChI | InChI=1S/C17H23N3.2ClH/c1-13-10-14(16-7-3-4-8-17(16)19-13)11-20-9-5-6-15(12-20)18-2;;/h3-4,7-8,10,15,18H,5-6,9,11-12H2,1-2H3;2*1H |
| InChIKey | KHYGZCOUVDWGOU-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.31 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |