C18H27Cl2N3 — CID 119920625
1-[1-[(2-methylquinolin-4-yl)methyl]piperidin-4-yl]ethanamine;dihydrochloride (PubChem CID 119920625) has the molecular formula C18H27Cl2N3 and a molecular weight of 356.34 g/mol. Its IUPAC name is 1-[1-[(2-methylquinolin-4-yl)methyl]piperidin-4-yl]ethanamine;dihydrochloride.
| Compound Name | 1-[1-[(2-methylquinolin-4-yl)methyl]piperidin-4-yl]ethanamine;dihydrochloride |
|---|---|
| PubChem CID | 119920625 |
| Molecular Formula | C18H27Cl2N3 |
| Molecular Weight | 356.34 g/mol |
| Exact Mass | 355.16 |
| IUPAC Name | 1-[1-[(2-methylquinolin-4-yl)methyl]piperidin-4-yl]ethanamine;dihydrochloride |
| SMILES | Cc1cc(CN2CCC(C(C)N)CC2)c2ccccc2n1.Cl.Cl |
| InChI | InChI=1S/C18H25N3.2ClH/c1-13-11-16(17-5-3-4-6-18(17)20-13)12-21-9-7-15(8-10-21)14(2)19;;/h3-6,11,14-15H,7-10,12,19H2,1-2H3;2*1H |
| InChIKey | HGXNWSXMOGPBHX-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.34 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |