C16H23Cl2N3 — CID 119905590
N-methyl-1-[(2-methylquinolin-4-yl)methyl]pyrrolidin-3-amine;dihydrochloride (PubChem CID 119905590) has the molecular formula C16H23Cl2N3 and a molecular weight of 328.29 g/mol. Its IUPAC name is N-methyl-1-[(2-methylquinolin-4-yl)methyl]pyrrolidin-3-amine;dihydrochloride.
| Compound Name | N-methyl-1-[(2-methylquinolin-4-yl)methyl]pyrrolidin-3-amine;dihydrochloride |
|---|---|
| PubChem CID | 119905590 |
| Molecular Formula | C16H23Cl2N3 |
| Molecular Weight | 328.29 g/mol |
| Exact Mass | 327.13 |
| IUPAC Name | N-methyl-1-[(2-methylquinolin-4-yl)methyl]pyrrolidin-3-amine;dihydrochloride |
| SMILES | CNC1CCN(Cc2cc(C)nc3ccccc23)C1.Cl.Cl |
| InChI | InChI=1S/C16H21N3.2ClH/c1-12-9-13(10-19-8-7-14(11-19)17-2)15-5-3-4-6-16(15)18-12;;/h3-6,9,14,17H,7-8,10-11H2,1-2H3;2*1H |
| InChIKey | BMAWDVSFQHCPBO-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.29 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |