C18H23N3 — CID 81495492
4-(3,9-diazabicyclo[4.2.1]nonan-3-ylmethyl)-2-methylquinoline (PubChem CID 81495492) has the molecular formula C18H23N3 and a molecular weight of 281.40 g/mol. Its IUPAC name is 4-(3,9-diazabicyclo[4.2.1]nonan-3-ylmethyl)-2-methylquinoline.
| Compound Name | 4-(3,9-diazabicyclo[4.2.1]nonan-3-ylmethyl)-2-methylquinoline |
|---|---|
| PubChem CID | 81495492 |
| Molecular Formula | C18H23N3 |
| Molecular Weight | 281.40 g/mol |
| Exact Mass | 281.19 |
| IUPAC Name | 4-(3,9-diazabicyclo[4.2.1]nonan-3-ylmethyl)-2-methylquinoline |
| SMILES | Cc1cc(CN2CCC3CCC(C2)N3)c2ccccc2n1 |
| InChI | InChI=1S/C18H23N3/c1-13-10-14(17-4-2-3-5-18(17)19-13)11-21-9-8-15-6-7-16(12-21)20-15/h2-5,10,15-16,20H,6-9,11-12H2,1H3 |
| InChIKey | IIAFUVIYZLSDFF-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.40 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |