C15H20N4 — CID 115314474
2-(3,9-diazabicyclo[4.2.1]nonan-3-ylmethyl)-1H-benzimidazole (PubChem CID 115314474) has the molecular formula C15H20N4 and a molecular weight of 256.35 g/mol. Its IUPAC name is 2-(3,9-diazabicyclo[4.2.1]nonan-3-ylmethyl)-1H-benzimidazole.
| Compound Name | 2-(3,9-diazabicyclo[4.2.1]nonan-3-ylmethyl)-1H-benzimidazole |
|---|---|
| PubChem CID | 115314474 |
| Molecular Formula | C15H20N4 |
| Molecular Weight | 256.35 g/mol |
| Exact Mass | 256.17 |
| IUPAC Name | 2-(3,9-diazabicyclo[4.2.1]nonan-3-ylmethyl)-1H-benzimidazole |
| SMILES | c1ccc2[nH]c(CN3CCC4CCC(C3)N4)nc2c1 |
| InChI | InChI=1S/C15H20N4/c1-2-4-14-13(3-1)17-15(18-14)10-19-8-7-11-5-6-12(9-19)16-11/h1-4,11-12,16H,5-10H2,(H,17,18) |
| InChIKey | NAWTXVDHFYTOBO-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 43.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.35 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |