C23H29N5 — CID 45199332
2-[[3-[1-(pyridin-3-ylmethyl)piperidin-4-yl]pyrrolidin-1-yl]methyl]-1H-benzimidazole (PubChem CID 45199332) has the molecular formula C23H29N5 and a molecular weight of 375.52 g/mol. Its IUPAC name is 2-[[3-[1-(pyridin-3-ylmethyl)piperidin-4-yl]pyrrolidin-1-yl]methyl]-1H-benzimidazole.
| Compound Name | 2-[[3-[1-(pyridin-3-ylmethyl)piperidin-4-yl]pyrrolidin-1-yl]methyl]-1H-benzimidazole |
|---|---|
| PubChem CID | 45199332 |
| Molecular Formula | C23H29N5 |
| Molecular Weight | 375.52 g/mol |
| Exact Mass | 375.24 |
| IUPAC Name | 2-[[3-[1-(pyridin-3-ylmethyl)piperidin-4-yl]pyrrolidin-1-yl]methyl]-1H-benzimidazole |
| SMILES | c1cncc(CN2CCC(C3CCN(Cc4nc5ccccc5[nH]4)C3)CC2)c1 |
| InChI | InChI=1S/C23H29N5/c1-2-6-22-21(5-1)25-23(26-22)17-28-13-9-20(16-28)19-7-11-27(12-8-19)15-18-4-3-10-24-14-18/h1-6,10,14,19-20H,7-9,11-13,15-17H2,(H,25,26) |
| InChIKey | SUDBQRVSXVYQOC-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 48.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.52 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |