C16H24Cl2N4 — CID 154924128
(4aR,8aS)-6-(1H-benzimidazol-2-ylmethyl)-2,3,4,4a,5,7,8,8a-octahydro-1H-1,6-naphthyridine;dihydrochloride (PubChem CID 154924128) has the molecular formula C16H24Cl2N4 and a molecular weight of 343.30 g/mol. Its IUPAC name is (4aR,8aS)-6-(1H-benzimidazol-2-ylmethyl)-2,3,4,4a,5,7,8,8a-octahydro-1H-1,6-naphthyridine;dihydrochloride.
| Compound Name | (4aR,8aS)-6-(1H-benzimidazol-2-ylmethyl)-2,3,4,4a,5,7,8,8a-octahydro-1H-1,6-naphthyridine;dihydrochloride |
|---|---|
| PubChem CID | 154924128 |
| Molecular Formula | C16H24Cl2N4 |
| Molecular Weight | 343.30 g/mol |
| Exact Mass | 342.14 |
| IUPAC Name | (4aR,8aS)-6-(1H-benzimidazol-2-ylmethyl)-2,3,4,4a,5,7,8,8a-octahydro-1H-1,6-naphthyridine;dihydrochloride |
| SMILES | Cl.Cl.c1ccc2[nH]c(CN3CC[C@@H]4NCCC[C@@H]4C3)nc2c1 |
| InChI | InChI=1S/C16H22N4.2ClH/c1-2-6-15-14(5-1)18-16(19-15)11-20-9-7-13-12(10-20)4-3-8-17-13;;/h1-2,5-6,12-13,17H,3-4,7-11H2,(H,18,19);2*1H/t12-,13+;;/m1../s1 |
| InChIKey | SMHJHLRZWNWKQN-VAALMUBNSA-N |
| XLogP | 2.98 |
| TPSA | 43.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.30 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |