C17H26N4 — CID 63241392
N-[[1-(1H-benzimidazol-2-ylmethyl)piperidin-3-yl]methyl]propan-2-amine (PubChem CID 63241392) has the molecular formula C17H26N4 and a molecular weight of 286.42 g/mol. Its IUPAC name is N-[[1-(1H-benzimidazol-2-ylmethyl)piperidin-3-yl]methyl]propan-2-amine.
| Compound Name | N-[[1-(1H-benzimidazol-2-ylmethyl)piperidin-3-yl]methyl]propan-2-amine |
|---|---|
| PubChem CID | 63241392 |
| Molecular Formula | C17H26N4 |
| Molecular Weight | 286.42 g/mol |
| Exact Mass | 286.22 |
| IUPAC Name | N-[[1-(1H-benzimidazol-2-ylmethyl)piperidin-3-yl]methyl]propan-2-amine |
| SMILES | CC(C)NCC1CCCN(Cc2nc3ccccc3[nH]2)C1 |
| InChI | InChI=1S/C17H26N4/c1-13(2)18-10-14-6-5-9-21(11-14)12-17-19-15-7-3-4-8-16(15)20-17/h3-4,7-8,13-14,18H,5-6,9-12H2,1-2H3,(H,19,20) |
| InChIKey | ICRZAAOYSTUULX-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 43.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.42 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |