C13H19Cl2N3 — CID 3063303
2-(piperidin-1-ylmethyl)-1H-benzimidazole;dihydrochloride (PubChem CID 3063303) has the molecular formula C13H19Cl2N3 and a molecular weight of 288.22 g/mol. Its IUPAC name is 2-(piperidin-1-ylmethyl)-1H-benzimidazole;dihydrochloride.
| Compound Name | 2-(piperidin-1-ylmethyl)-1H-benzimidazole;dihydrochloride |
|---|---|
| PubChem CID | 3063303 |
| Molecular Formula | C13H19Cl2N3 |
| Molecular Weight | 288.22 g/mol |
| Exact Mass | 287.10 |
| IUPAC Name | 2-(piperidin-1-ylmethyl)-1H-benzimidazole;dihydrochloride |
| SMILES | Cl.Cl.c1ccc2[nH]c(CN3CCCCC3)nc2c1 |
| InChI | InChI=1S/C13H17N3.2ClH/c1-4-8-16(9-5-1)10-13-14-11-6-2-3-7-12(11)15-13;;/h2-3,6-7H,1,4-5,8-10H2,(H,14,15);2*1H |
| InChIKey | FVDBPIYLZAACQX-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 31.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.22 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |