C14H17N3 — CID 122244910
2-[(3-methylidenepiperidin-1-yl)methyl]-1H-benzimidazole (PubChem CID 122244910) has the molecular formula C14H17N3 and a molecular weight of 227.31 g/mol. Its IUPAC name is 2-[(3-methylidenepiperidin-1-yl)methyl]-1H-benzimidazole.
| Compound Name | 2-[(3-methylidenepiperidin-1-yl)methyl]-1H-benzimidazole |
|---|---|
| PubChem CID | 122244910 |
| Molecular Formula | C14H17N3 |
| Molecular Weight | 227.31 g/mol |
| Exact Mass | 227.14 |
| IUPAC Name | 2-[(3-methylidenepiperidin-1-yl)methyl]-1H-benzimidazole |
| SMILES | C=C1CCCN(Cc2nc3ccccc3[nH]2)C1 |
| InChI | InChI=1S/C14H17N3/c1-11-5-4-8-17(9-11)10-14-15-12-6-2-3-7-13(12)16-14/h2-3,6-7H,1,4-5,8-10H2,(H,15,16) |
| InChIKey | CSEWJXFUUAEAJC-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 31.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.31 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|