C21H31N5 — CID 126892606
2-[[3-(4-cyclohexylpiperazin-1-yl)azetidin-1-yl]methyl]-1H-benzimidazole (PubChem CID 126892606) has the molecular formula C21H31N5 and a molecular weight of 353.51 g/mol. Its IUPAC name is 2-[[3-(4-cyclohexylpiperazin-1-yl)azetidin-1-yl]methyl]-1H-benzimidazole.
| Compound Name | 2-[[3-(4-cyclohexylpiperazin-1-yl)azetidin-1-yl]methyl]-1H-benzimidazole |
|---|---|
| PubChem CID | 126892606 |
| Molecular Formula | C21H31N5 |
| Molecular Weight | 353.51 g/mol |
| Exact Mass | 353.26 |
| IUPAC Name | 2-[[3-(4-cyclohexylpiperazin-1-yl)azetidin-1-yl]methyl]-1H-benzimidazole |
| SMILES | c1ccc2[nH]c(CN3CC(N4CCN(C5CCCCC5)CC4)C3)nc2c1 |
| InChI | InChI=1S/C21H31N5/c1-2-6-17(7-3-1)25-10-12-26(13-11-25)18-14-24(15-18)16-21-22-19-8-4-5-9-20(19)23-21/h4-5,8-9,17-18H,1-3,6-7,10-16H2,(H,22,23) |
| InChIKey | ZTASSBTVBFVKKL-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 38.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.51 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |