C15H22N4 — CID 142265346
2-[(4-ethyl-1,4-diazepan-1-yl)methyl]-1H-benzimidazole (PubChem CID 142265346) has the molecular formula C15H22N4 and a molecular weight of 258.37 g/mol. Its IUPAC name is 2-[(4-ethyl-1,4-diazepan-1-yl)methyl]-1H-benzimidazole.
| Compound Name | 2-[(4-ethyl-1,4-diazepan-1-yl)methyl]-1H-benzimidazole |
|---|---|
| PubChem CID | 142265346 |
| Molecular Formula | C15H22N4 |
| Molecular Weight | 258.37 g/mol |
| Exact Mass | 258.18 |
| IUPAC Name | 2-[(4-ethyl-1,4-diazepan-1-yl)methyl]-1H-benzimidazole |
| SMILES | CCN1CCCN(Cc2nc3ccccc3[nH]2)CC1 |
| InChI | InChI=1S/C15H22N4/c1-2-18-8-5-9-19(11-10-18)12-15-16-13-6-3-4-7-14(13)17-15/h3-4,6-7H,2,5,8-12H2,1H3,(H,16,17) |
| InChIKey | GTKLHPWFJFOBEQ-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 35.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.37 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |