C20H24N4 — CID 11738728
2-[[4-(2,5-dimethylphenyl)piperazin-1-yl]methyl]-1H-benzimidazole (PubChem CID 11738728) has the molecular formula C20H24N4 and a molecular weight of 320.44 g/mol. Its IUPAC name is 2-[[4-(2,5-dimethylphenyl)piperazin-1-yl]methyl]-1H-benzimidazole.
| Compound Name | 2-[[4-(2,5-dimethylphenyl)piperazin-1-yl]methyl]-1H-benzimidazole |
|---|---|
| PubChem CID | 11738728 |
| Molecular Formula | C20H24N4 |
| Molecular Weight | 320.44 g/mol |
| Exact Mass | 320.20 |
| IUPAC Name | 2-[[4-(2,5-dimethylphenyl)piperazin-1-yl]methyl]-1H-benzimidazole |
| SMILES | Cc1ccc(C)c(N2CCN(Cc3nc4ccccc4[nH]3)CC2)c1 |
| InChI | InChI=1S/C20H24N4/c1-15-7-8-16(2)19(13-15)24-11-9-23(10-12-24)14-20-21-17-5-3-4-6-18(17)22-20/h3-8,13H,9-12,14H2,1-2H3,(H,21,22) |
| InChIKey | DUDRAXFTMQLSMY-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 35.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.44 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |