C13H19N5O2S — CID 171910596
4-[(6-methyl-1H-benzimidazol-2-yl)methyl]piperazine-1-sulfonamide (PubChem CID 171910596) has the molecular formula C13H19N5O2S and a molecular weight of 309.39 g/mol. Its IUPAC name is 4-[(6-methyl-1H-benzimidazol-2-yl)methyl]piperazine-1-sulfonamide.
| Compound Name | 4-[(6-methyl-1H-benzimidazol-2-yl)methyl]piperazine-1-sulfonamide |
|---|---|
| PubChem CID | 171910596 |
| Molecular Formula | C13H19N5O2S |
| Molecular Weight | 309.39 g/mol |
| Exact Mass | 309.13 |
| IUPAC Name | 4-[(6-methyl-1H-benzimidazol-2-yl)methyl]piperazine-1-sulfonamide |
| SMILES | Cc1ccc2nc(CN3CCN(S(N)(=O)=O)CC3)[nH]c2c1 |
| InChI | InChI=1S/C13H19N5O2S/c1-10-2-3-11-12(8-10)16-13(15-11)9-17-4-6-18(7-5-17)21(14,19)20/h2-3,8H,4-7,9H2,1H3,(H,15,16)(H2,14,19,20) |
| InChIKey | HQPGEEPZYLQQIN-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 95.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.39 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |