C14H20N4O2S — CID 62823587
2-(1,4-diazepan-1-ylmethyl)-6-methylsulfonyl-1H-benzimidazole (PubChem CID 62823587) has the molecular formula C14H20N4O2S and a molecular weight of 308.41 g/mol. Its IUPAC name is 2-(1,4-diazepan-1-ylmethyl)-6-methylsulfonyl-1H-benzimidazole.
| Compound Name | 2-(1,4-diazepan-1-ylmethyl)-6-methylsulfonyl-1H-benzimidazole |
|---|---|
| PubChem CID | 62823587 |
| Molecular Formula | C14H20N4O2S |
| Molecular Weight | 308.41 g/mol |
| Exact Mass | 308.13 |
| IUPAC Name | 2-(1,4-diazepan-1-ylmethyl)-6-methylsulfonyl-1H-benzimidazole |
| SMILES | CS(=O)(=O)c1ccc2nc(CN3CCCNCC3)[nH]c2c1 |
| InChI | InChI=1S/C14H20N4O2S/c1-21(19,20)11-3-4-12-13(9-11)17-14(16-12)10-18-7-2-5-15-6-8-18/h3-4,9,15H,2,5-8,10H2,1H3,(H,16,17) |
| InChIKey | QHQUXYOKBAFXNB-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 78.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.41 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |