About 2-(1,4-diazepan-1-ylmethyl)-4,6-dimethyl-1H-benzimidazole
2-(1,4-diazepan-1-ylmethyl)-4,6-dimethyl-1H-benzimidazole (PubChem CID 82946850) has the molecular formula C15H22N4
and a molecular weight of 258.37 g/mol. Its IUPAC name is 2-(1,4-diazepan-1-ylmethyl)-4,6-dimethyl-1H-benzimidazole.
Molecular Properties
| Compound Name | 2-(1,4-diazepan-1-ylmethyl)-4,6-dimethyl-1H-benzimidazole |
| PubChem CID | 82946850 |
| Molecular Formula | C15H22N4 |
| Molecular Weight | 258.37 g/mol |
| Exact Mass | 258.18 |
| IUPAC Name | 2-(1,4-diazepan-1-ylmethyl)-4,6-dimethyl-1H-benzimidazole |
| SMILES | Cc1cc(C)c2nc(CN3CCCNCC3)[nH]c2c1 |
| InChI | InChI=1S/C15H22N4/c1-11-8-12(2)15-13(9-11)17-14(18-15)10-19-6-3-4-16-5-7-19/h8-9,16H,3-7,10H2,1-2H3,(H,17,18) |
| InChIKey | OIODBFSRWOQQKK-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 43.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.37 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(1,4-diazepan-1-ylmethyl)-4,6-dimethyl-1H-benzimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1,4-diazepan-1-ylmethyl)-4,6-dimethyl-1H-benzimidazole?
The IUPAC name of 2-(1,4-diazepan-1-ylmethyl)-4,6-dimethyl-1H-benzimidazole (CID 82946850) is 2-(1,4-diazepan-1-ylmethyl)-4,6-dimethyl-1H-benzimidazole.
What is the SMILES notation for 2-(1,4-diazepan-1-ylmethyl)-4,6-dimethyl-1H-benzimidazole?
The canonical SMILES for 2-(1,4-diazepan-1-ylmethyl)-4,6-dimethyl-1H-benzimidazole is Cc1cc(C)c2nc(CN3CCCNCC3)[nH]c2c1.
What is the InChIKey of 2-(1,4-diazepan-1-ylmethyl)-4,6-dimethyl-1H-benzimidazole?
The InChIKey is OIODBFSRWOQQKK-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H22N4/c1-11-8-12(2)15-13(9-11)17-14(18-15)10-19-6-3-4-16-5-7-19/h8-9,16H,3-7,10H2,1-2H3,(H,17,18).
What are the key properties of 2-(1,4-diazepan-1-ylmethyl)-4,6-dimethyl-1H-benzimidazole?
2-(1,4-diazepan-1-ylmethyl)-4,6-dimethyl-1H-benzimidazole has a molecular weight of 258.37 g/mol, XLogP of 1.98, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,4-diazepan-1-ylmethyl)-4,6-dimethyl-1H-benzimidazole is sourced from PubChem (CID 82946850), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).