C12H14F2N4 — CID 112556569
4,5-difluoro-2-(piperazin-1-ylmethyl)-1H-benzimidazole (PubChem CID 112556569) has the molecular formula C12H14F2N4 and a molecular weight of 252.27 g/mol. Its IUPAC name is 4,5-difluoro-2-(piperazin-1-ylmethyl)-1H-benzimidazole.
| Compound Name | 4,5-difluoro-2-(piperazin-1-ylmethyl)-1H-benzimidazole |
|---|---|
| PubChem CID | 112556569 |
| Molecular Formula | C12H14F2N4 |
| Molecular Weight | 252.27 g/mol |
| Exact Mass | 252.12 |
| IUPAC Name | 4,5-difluoro-2-(piperazin-1-ylmethyl)-1H-benzimidazole |
| SMILES | Fc1ccc2[nH]c(CN3CCNCC3)nc2c1F |
| InChI | InChI=1S/C12H14F2N4/c13-8-1-2-9-12(11(8)14)17-10(16-9)7-18-5-3-15-4-6-18/h1-2,15H,3-7H2,(H,16,17) |
| InChIKey | VHMTYOZCRFWFJT-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 43.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.27 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |