C12H17N5O — CID 65483646
5-methoxy-2-(piperazin-1-ylmethyl)-1H-imidazo[4,5-b]pyridine (PubChem CID 65483646) has the molecular formula C12H17N5O and a molecular weight of 247.30 g/mol. Its IUPAC name is 5-methoxy-2-(piperazin-1-ylmethyl)-1H-imidazo[4,5-b]pyridine.
| Compound Name | 5-methoxy-2-(piperazin-1-ylmethyl)-1H-imidazo[4,5-b]pyridine |
|---|---|
| PubChem CID | 65483646 |
| Molecular Formula | C12H17N5O |
| Molecular Weight | 247.30 g/mol |
| Exact Mass | 247.14 |
| IUPAC Name | 5-methoxy-2-(piperazin-1-ylmethyl)-1H-imidazo[4,5-b]pyridine |
| SMILES | COc1ccc2[nH]c(CN3CCNCC3)nc2n1 |
| InChI | InChI=1S/C12H17N5O/c1-18-11-3-2-9-12(16-11)15-10(14-9)8-17-6-4-13-5-7-17/h2-3,13H,4-8H2,1H3,(H,14,15,16) |
| InChIKey | VVAVJYOXZIAQBL-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 66.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.30 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |