C11H11ClF2N2 — CID 112556642
2-(4-chlorobutyl)-4,5-difluoro-1H-benzimidazole (PubChem CID 112556642) has the molecular formula C11H11ClF2N2 and a molecular weight of 244.67 g/mol. Its IUPAC name is 2-(4-chlorobutyl)-4,5-difluoro-1H-benzimidazole.
| Compound Name | 2-(4-chlorobutyl)-4,5-difluoro-1H-benzimidazole |
|---|---|
| PubChem CID | 112556642 |
| Molecular Formula | C11H11ClF2N2 |
| Molecular Weight | 244.67 g/mol |
| Exact Mass | 244.06 |
| IUPAC Name | 2-(4-chlorobutyl)-4,5-difluoro-1H-benzimidazole |
| SMILES | Fc1ccc2[nH]c(CCCCCl)nc2c1F |
| InChI | InChI=1S/C11H11ClF2N2/c12-6-2-1-3-9-15-8-5-4-7(13)10(14)11(8)16-9/h4-5H,1-3,6H2,(H,15,16) |
| InChIKey | RWDPAYPJSZLLFX-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.67 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|