C15H13F2N3 — CID 107272709
2-[2-(4,5-difluoro-1H-benzimidazol-2-yl)ethyl]aniline (PubChem CID 107272709) has the molecular formula C15H13F2N3 and a molecular weight of 273.29 g/mol. Its IUPAC name is 2-[2-(4,5-difluoro-1H-benzimidazol-2-yl)ethyl]aniline.
| Compound Name | 2-[2-(4,5-difluoro-1H-benzimidazol-2-yl)ethyl]aniline |
|---|---|
| PubChem CID | 107272709 |
| Molecular Formula | C15H13F2N3 |
| Molecular Weight | 273.29 g/mol |
| Exact Mass | 273.11 |
| IUPAC Name | 2-[2-(4,5-difluoro-1H-benzimidazol-2-yl)ethyl]aniline |
| SMILES | Nc1ccccc1CCc1nc2c(F)c(F)ccc2[nH]1 |
| InChI | InChI=1S/C15H13F2N3/c16-10-6-7-12-15(14(10)17)20-13(19-12)8-5-9-3-1-2-4-11(9)18/h1-4,6-7H,5,8,18H2,(H,19,20) |
| InChIKey | APDGPBODNSZKBG-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.29 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|