C16H23N3 — CID 84636758
3,4,6-trimethyl-2-(piperazin-1-ylmethyl)-1H-indole (PubChem CID 84636758) has the molecular formula C16H23N3 and a molecular weight of 257.38 g/mol. Its IUPAC name is 3,4,6-trimethyl-2-(piperazin-1-ylmethyl)-1H-indole.
| Compound Name | 3,4,6-trimethyl-2-(piperazin-1-ylmethyl)-1H-indole |
|---|---|
| PubChem CID | 84636758 |
| Molecular Formula | C16H23N3 |
| Molecular Weight | 257.38 g/mol |
| Exact Mass | 257.19 |
| IUPAC Name | 3,4,6-trimethyl-2-(piperazin-1-ylmethyl)-1H-indole |
| SMILES | Cc1cc(C)c2c(C)c(CN3CCNCC3)[nH]c2c1 |
| InChI | InChI=1S/C16H23N3/c1-11-8-12(2)16-13(3)15(18-14(16)9-11)10-19-6-4-17-5-7-19/h8-9,17-18H,4-7,10H2,1-3H3 |
| InChIKey | DUAZDZHOEJKYQU-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 31.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.38 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |