C19H21ClN4 — CID 134084457
2-[(4-benzylpiperazin-1-yl)methyl]-6-chloro-1H-benzimidazole (PubChem CID 134084457) has the molecular formula C19H21ClN4 and a molecular weight of 340.86 g/mol. Its IUPAC name is 2-[(4-benzylpiperazin-1-yl)methyl]-6-chloro-1H-benzimidazole.
| Compound Name | 2-[(4-benzylpiperazin-1-yl)methyl]-6-chloro-1H-benzimidazole |
|---|---|
| PubChem CID | 134084457 |
| Molecular Formula | C19H21ClN4 |
| Molecular Weight | 340.86 g/mol |
| Exact Mass | 340.15 |
| IUPAC Name | 2-[(4-benzylpiperazin-1-yl)methyl]-6-chloro-1H-benzimidazole |
| SMILES | Clc1ccc2nc(CN3CCN(Cc4ccccc4)CC3)[nH]c2c1 |
| InChI | InChI=1S/C19H21ClN4/c20-16-6-7-17-18(12-16)22-19(21-17)14-24-10-8-23(9-11-24)13-15-4-2-1-3-5-15/h1-7,12H,8-11,13-14H2,(H,21,22) |
| InChIKey | JEZSOYBBJVUUHB-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 35.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.86 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |