C20H20Cl2N4O — CID 135951727
7-chloro-2-[[4-[(4-chlorophenyl)methyl]piperazin-1-yl]methyl]-3H-quinazolin-4-one (PubChem CID 135951727) has the molecular formula C20H20Cl2N4O and a molecular weight of 403.31 g/mol. Its IUPAC name is 7-chloro-2-[[4-[(4-chlorophenyl)methyl]piperazin-1-yl]methyl]-3H-quinazolin-4-one.
| Compound Name | 7-chloro-2-[[4-[(4-chlorophenyl)methyl]piperazin-1-yl]methyl]-3H-quinazolin-4-one |
|---|---|
| PubChem CID | 135951727 |
| Molecular Formula | C20H20Cl2N4O |
| Molecular Weight | 403.31 g/mol |
| Exact Mass | 402.10 |
| IUPAC Name | 7-chloro-2-[[4-[(4-chlorophenyl)methyl]piperazin-1-yl]methyl]-3H-quinazolin-4-one |
| SMILES | O=c1[nH]c(CN2CCN(Cc3ccc(Cl)cc3)CC2)nc2cc(Cl)ccc12 |
| InChI | InChI=1S/C20H20Cl2N4O/c21-15-3-1-14(2-4-15)12-25-7-9-26(10-8-25)13-19-23-18-11-16(22)5-6-17(18)20(27)24-19/h1-6,11H,7-10,12-13H2,(H,23,24,27) |
| InChIKey | ZSKOPTQZLCWWDH-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 52.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.31 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |