C17H20ClN3O3 — CID 135543495
ethyl 1-[(7-chloro-4-oxo-3H-quinazolin-2-yl)methyl]piperidine-4-carboxylate (PubChem CID 135543495) has the molecular formula C17H20ClN3O3 and a molecular weight of 349.82 g/mol. Its IUPAC name is ethyl 1-[(7-chloro-4-oxo-3H-quinazolin-2-yl)methyl]piperidine-4-carboxylate.
| Compound Name | ethyl 1-[(7-chloro-4-oxo-3H-quinazolin-2-yl)methyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 135543495 |
| Molecular Formula | C17H20ClN3O3 |
| Molecular Weight | 349.82 g/mol |
| Exact Mass | 349.12 |
| IUPAC Name | ethyl 1-[(7-chloro-4-oxo-3H-quinazolin-2-yl)methyl]piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(Cc2nc3cc(Cl)ccc3c(=O)[nH]2)CC1 |
| InChI | InChI=1S/C17H20ClN3O3/c1-2-24-17(23)11-5-7-21(8-6-11)10-15-19-14-9-12(18)3-4-13(14)16(22)20-15/h3-4,9,11H,2,5-8,10H2,1H3,(H,19,20,22) |
| InChIKey | KCUYMZSUUVLOSL-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 75.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.82 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |