C15H17ClN2O3 — CID 46735169
ethyl 1-(5-chloro-1,3-benzoxazol-2-yl)piperidine-4-carboxylate (PubChem CID 46735169) has the molecular formula C15H17ClN2O3 and a molecular weight of 308.76 g/mol. Its IUPAC name is ethyl 1-(5-chloro-1,3-benzoxazol-2-yl)piperidine-4-carboxylate.
| Compound Name | ethyl 1-(5-chloro-1,3-benzoxazol-2-yl)piperidine-4-carboxylate |
|---|---|
| PubChem CID | 46735169 |
| Molecular Formula | C15H17ClN2O3 |
| Molecular Weight | 308.76 g/mol |
| Exact Mass | 308.09 |
| IUPAC Name | ethyl 1-(5-chloro-1,3-benzoxazol-2-yl)piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(c2nc3cc(Cl)ccc3o2)CC1 |
| InChI | InChI=1S/C15H17ClN2O3/c1-2-20-14(19)10-5-7-18(8-6-10)15-17-12-9-11(16)3-4-13(12)21-15/h3-4,9-10H,2,5-8H2,1H3 |
| InChIKey | UKGWPSXLRJPKIP-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 55.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.76 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |