C13H15ClN2O2 — CID 172882629
[1-(5-chloro-1,3-benzoxazol-2-yl)piperidin-4-yl]methanol (PubChem CID 172882629) has the molecular formula C13H15ClN2O2 and a molecular weight of 266.73 g/mol. Its IUPAC name is [1-(5-chloro-1,3-benzoxazol-2-yl)piperidin-4-yl]methanol.
| Compound Name | [1-(5-chloro-1,3-benzoxazol-2-yl)piperidin-4-yl]methanol |
|---|---|
| PubChem CID | 172882629 |
| Molecular Formula | C13H15ClN2O2 |
| Molecular Weight | 266.73 g/mol |
| Exact Mass | 266.08 |
| IUPAC Name | [1-(5-chloro-1,3-benzoxazol-2-yl)piperidin-4-yl]methanol |
| SMILES | OCC1CCN(c2nc3cc(Cl)ccc3o2)CC1 |
| InChI | InChI=1S/C13H15ClN2O2/c14-10-1-2-12-11(7-10)15-13(18-12)16-5-3-9(8-17)4-6-16/h1-2,7,9,17H,3-6,8H2 |
| InChIKey | KBUUTOUNVSIHTQ-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 49.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.73 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |