C12H14N2O2 — CID 62371883
[1-(1,3-benzoxazol-2-yl)pyrrolidin-3-yl]methanol (PubChem CID 62371883) has the molecular formula C12H14N2O2 and a molecular weight of 218.26 g/mol. Its IUPAC name is [1-(1,3-benzoxazol-2-yl)pyrrolidin-3-yl]methanol.
| Compound Name | [1-(1,3-benzoxazol-2-yl)pyrrolidin-3-yl]methanol |
|---|---|
| PubChem CID | 62371883 |
| Molecular Formula | C12H14N2O2 |
| Molecular Weight | 218.26 g/mol |
| Exact Mass | 218.11 |
| IUPAC Name | [1-(1,3-benzoxazol-2-yl)pyrrolidin-3-yl]methanol |
| SMILES | OCC1CCN(c2nc3ccccc3o2)C1 |
| InChI | InChI=1S/C12H14N2O2/c15-8-9-5-6-14(7-9)12-13-10-3-1-2-4-11(10)16-12/h1-4,9,15H,5-8H2 |
| InChIKey | SEJUXEXNFRZDGV-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 49.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.26 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |