C11H12N2O3 — CID 106673452
1-(1,3-benzoxazol-2-yl)pyrrolidine-3,4-diol (PubChem CID 106673452) has the molecular formula C11H12N2O3 and a molecular weight of 220.23 g/mol. Its IUPAC name is 1-(1,3-benzoxazol-2-yl)pyrrolidine-3,4-diol.
| Compound Name | 1-(1,3-benzoxazol-2-yl)pyrrolidine-3,4-diol |
|---|---|
| PubChem CID | 106673452 |
| Molecular Formula | C11H12N2O3 |
| Molecular Weight | 220.23 g/mol |
| Exact Mass | 220.08 |
| IUPAC Name | 1-(1,3-benzoxazol-2-yl)pyrrolidine-3,4-diol |
| SMILES | OC1CN(c2nc3ccccc3o2)CC1O |
| InChI | InChI=1S/C11H12N2O3/c14-8-5-13(6-9(8)15)11-12-7-3-1-2-4-10(7)16-11/h1-4,8-9,14-15H,5-6H2 |
| InChIKey | ZYYUTGVDNYBDSQ-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 69.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.23 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |