C19H18N4O2 — CID 14792326
2-[4-(1,3-benzoxazol-2-yl)-1,4-diazepan-1-yl]-1,3-benzoxazole (PubChem CID 14792326) has the molecular formula C19H18N4O2 and a molecular weight of 334.38 g/mol. Its IUPAC name is 2-[4-(1,3-benzoxazol-2-yl)-1,4-diazepan-1-yl]-1,3-benzoxazole.
| Compound Name | 2-[4-(1,3-benzoxazol-2-yl)-1,4-diazepan-1-yl]-1,3-benzoxazole |
|---|---|
| PubChem CID | 14792326 |
| Molecular Formula | C19H18N4O2 |
| Molecular Weight | 334.38 g/mol |
| Exact Mass | 334.14 |
| IUPAC Name | 2-[4-(1,3-benzoxazol-2-yl)-1,4-diazepan-1-yl]-1,3-benzoxazole |
| SMILES | c1ccc2oc(N3CCCN(c4nc5ccccc5o4)CC3)nc2c1 |
| InChI | InChI=1S/C19H18N4O2/c1-3-8-16-14(6-1)20-18(24-16)22-10-5-11-23(13-12-22)19-21-15-7-2-4-9-17(15)25-19/h1-4,6-9H,5,10-13H2 |
| InChIKey | AOPAUUQFMKOUBS-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 58.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.38 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |