C13H13N5OS — CID 154581141
2-[4-(1,2,5-thiadiazol-3-yl)piperazin-1-yl]-1,3-benzoxazole (PubChem CID 154581141) has the molecular formula C13H13N5OS and a molecular weight of 287.35 g/mol. Its IUPAC name is 2-[4-(1,2,5-thiadiazol-3-yl)piperazin-1-yl]-1,3-benzoxazole.
| Compound Name | 2-[4-(1,2,5-thiadiazol-3-yl)piperazin-1-yl]-1,3-benzoxazole |
|---|---|
| PubChem CID | 154581141 |
| Molecular Formula | C13H13N5OS |
| Molecular Weight | 287.35 g/mol |
| Exact Mass | 287.08 |
| IUPAC Name | 2-[4-(1,2,5-thiadiazol-3-yl)piperazin-1-yl]-1,3-benzoxazole |
| SMILES | c1ccc2oc(N3CCN(c4cnsn4)CC3)nc2c1 |
| InChI | InChI=1S/C13H13N5OS/c1-2-4-11-10(3-1)15-13(19-11)18-7-5-17(6-8-18)12-9-14-20-16-12/h1-4,9H,5-8H2 |
| InChIKey | SUSDOUVRHXDMAQ-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 58.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.35 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |