C18H19N3O2 — CID 51179578
2-[4-(4-methoxyphenyl)piperazin-1-yl]-1,3-benzoxazole (PubChem CID 51179578) has the molecular formula C18H19N3O2 and a molecular weight of 309.37 g/mol. Its IUPAC name is 2-[4-(4-methoxyphenyl)piperazin-1-yl]-1,3-benzoxazole.
| Compound Name | 2-[4-(4-methoxyphenyl)piperazin-1-yl]-1,3-benzoxazole |
|---|---|
| PubChem CID | 51179578 |
| Molecular Formula | C18H19N3O2 |
| Molecular Weight | 309.37 g/mol |
| Exact Mass | 309.15 |
| IUPAC Name | 2-[4-(4-methoxyphenyl)piperazin-1-yl]-1,3-benzoxazole |
| SMILES | COc1ccc(N2CCN(c3nc4ccccc4o3)CC2)cc1 |
| InChI | InChI=1S/C18H19N3O2/c1-22-15-8-6-14(7-9-15)20-10-12-21(13-11-20)18-19-16-4-2-3-5-17(16)23-18/h2-9H,10-13H2,1H3 |
| InChIKey | OLWHKCCECNTAGO-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 41.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.37 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|