C19H21N3O2 — CID 146080024
2-[4-(2-phenoxyethyl)piperazin-1-yl]-1,3-benzoxazole (PubChem CID 146080024) has the molecular formula C19H21N3O2 and a molecular weight of 323.40 g/mol. Its IUPAC name is 2-[4-(2-phenoxyethyl)piperazin-1-yl]-1,3-benzoxazole.
| Compound Name | 2-[4-(2-phenoxyethyl)piperazin-1-yl]-1,3-benzoxazole |
|---|---|
| PubChem CID | 146080024 |
| Molecular Formula | C19H21N3O2 |
| Molecular Weight | 323.40 g/mol |
| Exact Mass | 323.16 |
| IUPAC Name | 2-[4-(2-phenoxyethyl)piperazin-1-yl]-1,3-benzoxazole |
| SMILES | c1ccc(OCCN2CCN(c3nc4ccccc4o3)CC2)cc1 |
| InChI | InChI=1S/C19H21N3O2/c1-2-6-16(7-3-1)23-15-14-21-10-12-22(13-11-21)19-20-17-8-4-5-9-18(17)24-19/h1-9H,10-15H2 |
| InChIKey | NCCUROCZYCSKOD-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 41.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.40 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |