C16H16N4O — CID 24805905
2-(4-pyridin-2-ylpiperazin-1-yl)-1,3-benzoxazole (PubChem CID 24805905) has the molecular formula C16H16N4O and a molecular weight of 280.33 g/mol. Its IUPAC name is 2-(4-pyridin-2-ylpiperazin-1-yl)-1,3-benzoxazole.
| Compound Name | 2-(4-pyridin-2-ylpiperazin-1-yl)-1,3-benzoxazole |
|---|---|
| PubChem CID | 24805905 |
| Molecular Formula | C16H16N4O |
| Molecular Weight | 280.33 g/mol |
| Exact Mass | 280.13 |
| IUPAC Name | 2-(4-pyridin-2-ylpiperazin-1-yl)-1,3-benzoxazole |
| SMILES | c1ccc(N2CCN(c3nc4ccccc4o3)CC2)nc1 |
| InChI | InChI=1S/C16H16N4O/c1-2-6-14-13(5-1)18-16(21-14)20-11-9-19(10-12-20)15-7-3-4-8-17-15/h1-8H,9-12H2 |
| InChIKey | SUCZGRSGFMGTLC-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 45.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.33 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |