C19H24ClN3O3 — CID 165432232
2-[1-(5-chloro-1,3-benzoxazol-2-yl)piperidin-4-yl]-N-(oxan-4-yl)acetamide (PubChem CID 165432232) has the molecular formula C19H24ClN3O3 and a molecular weight of 377.87 g/mol. Its IUPAC name is 2-[1-(5-chloro-1,3-benzoxazol-2-yl)piperidin-4-yl]-N-(oxan-4-yl)acetamide.
| Compound Name | 2-[1-(5-chloro-1,3-benzoxazol-2-yl)piperidin-4-yl]-N-(oxan-4-yl)acetamide |
|---|---|
| PubChem CID | 165432232 |
| Molecular Formula | C19H24ClN3O3 |
| Molecular Weight | 377.87 g/mol |
| Exact Mass | 377.15 |
| IUPAC Name | 2-[1-(5-chloro-1,3-benzoxazol-2-yl)piperidin-4-yl]-N-(oxan-4-yl)acetamide |
| SMILES | O=C(CC1CCN(c2nc3cc(Cl)ccc3o2)CC1)NC1CCOCC1 |
| InChI | InChI=1S/C19H24ClN3O3/c20-14-1-2-17-16(12-14)22-19(26-17)23-7-3-13(4-8-23)11-18(24)21-15-5-9-25-10-6-15/h1-2,12-13,15H,3-11H2,(H,21,24) |
| InChIKey | FFBWMFVIJOBAPF-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 67.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.87 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |