C18H22ClN3O3 — CID 154822947
1-(6-chloro-1,3-benzoxazol-2-yl)-N-(oxan-4-yl)piperidine-4-carboxamide (PubChem CID 154822947) has the molecular formula C18H22ClN3O3 and a molecular weight of 363.85 g/mol. Its IUPAC name is 1-(6-chloro-1,3-benzoxazol-2-yl)-N-(oxan-4-yl)piperidine-4-carboxamide.
| Compound Name | 1-(6-chloro-1,3-benzoxazol-2-yl)-N-(oxan-4-yl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 154822947 |
| Molecular Formula | C18H22ClN3O3 |
| Molecular Weight | 363.85 g/mol |
| Exact Mass | 363.13 |
| IUPAC Name | 1-(6-chloro-1,3-benzoxazol-2-yl)-N-(oxan-4-yl)piperidine-4-carboxamide |
| SMILES | O=C(NC1CCOCC1)C1CCN(c2nc3ccc(Cl)cc3o2)CC1 |
| InChI | InChI=1S/C18H22ClN3O3/c19-13-1-2-15-16(11-13)25-18(21-15)22-7-3-12(4-8-22)17(23)20-14-5-9-24-10-6-14/h1-2,11-12,14H,3-10H2,(H,20,23) |
| InChIKey | CWXUKWAVWAHCCY-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 67.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.85 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |