C17H21ClN4O3 — CID 154570414
N-(2-acetamidoethyl)-1-(6-chloro-1,3-benzoxazol-2-yl)piperidine-4-carboxamide (PubChem CID 154570414) has the molecular formula C17H21ClN4O3 and a molecular weight of 364.83 g/mol. Its IUPAC name is N-(2-acetamidoethyl)-1-(6-chloro-1,3-benzoxazol-2-yl)piperidine-4-carboxamide.
| Compound Name | N-(2-acetamidoethyl)-1-(6-chloro-1,3-benzoxazol-2-yl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 154570414 |
| Molecular Formula | C17H21ClN4O3 |
| Molecular Weight | 364.83 g/mol |
| Exact Mass | 364.13 |
| IUPAC Name | N-(2-acetamidoethyl)-1-(6-chloro-1,3-benzoxazol-2-yl)piperidine-4-carboxamide |
| SMILES | CC(=O)NCCNC(=O)C1CCN(c2nc3ccc(Cl)cc3o2)CC1 |
| InChI | InChI=1S/C17H21ClN4O3/c1-11(23)19-6-7-20-16(24)12-4-8-22(9-5-12)17-21-14-3-2-13(18)10-15(14)25-17/h2-3,10,12H,4-9H2,1H3,(H,19,23)(H,20,24) |
| InChIKey | ZTEHNLBBTKFDBE-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 87.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.83 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|