C17H23N3O2 — CID 15993683
1-(1,3-benzoxazol-2-yl)-N-butylpiperidine-4-carboxamide (PubChem CID 15993683) has the molecular formula C17H23N3O2 and a molecular weight of 301.39 g/mol. Its IUPAC name is 1-(1,3-benzoxazol-2-yl)-N-butylpiperidine-4-carboxamide.
| Compound Name | 1-(1,3-benzoxazol-2-yl)-N-butylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 15993683 |
| Molecular Formula | C17H23N3O2 |
| Molecular Weight | 301.39 g/mol |
| Exact Mass | 301.18 |
| IUPAC Name | 1-(1,3-benzoxazol-2-yl)-N-butylpiperidine-4-carboxamide |
| SMILES | CCCCNC(=O)C1CCN(c2nc3ccccc3o2)CC1 |
| InChI | InChI=1S/C17H23N3O2/c1-2-3-10-18-16(21)13-8-11-20(12-9-13)17-19-14-6-4-5-7-15(14)22-17/h4-7,13H,2-3,8-12H2,1H3,(H,18,21) |
| InChIKey | CVOJUONXEWWGOV-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 58.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.39 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|